C31H44O3 — CID 156632293
10,10-bis(2-ethylhexoxy)-2-methylanthracen-9-one (PubChem CID 156632293) has the molecular formula C31H44O3 and a molecular weight of 464.69 g/mol. Its IUPAC name is 10,10-bis(2-ethylhexoxy)-2-methylanthracen-9-one.
| Compound Name | 10,10-bis(2-ethylhexoxy)-2-methylanthracen-9-one |
|---|---|
| PubChem CID | 156632293 |
| Molecular Formula | C31H44O3 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | 10,10-bis(2-ethylhexoxy)-2-methylanthracen-9-one |
| SMILES | CCCCC(CC)COC1(OCC(CC)CCCC)c2ccccc2C(=O)c2cc(C)ccc21 |
| InChI | InChI=1S/C31H44O3/c1-6-10-14-24(8-3)21-33-31(34-22-25(9-4)15-11-7-2)28-17-13-12-16-26(28)30(32)27-20-23(5)18-19-29(27)31/h12-13,16-20,24-25H,6-11,14-15,21-22H2,1-5H3 |
| InChIKey | AABHCGHFYUEMPG-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|