C10H15N3O3 — CID 156636510
(2-methyl-5-oxo-1H-pyrazol-4-yl) piperidine-1-carboxylate (PubChem CID 156636510) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is (2-methyl-5-oxo-1H-pyrazol-4-yl) piperidine-1-carboxylate.
| Compound Name | (2-methyl-5-oxo-1H-pyrazol-4-yl) piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156636510 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | (2-methyl-5-oxo-1H-pyrazol-4-yl) piperidine-1-carboxylate |
| SMILES | Cn1cc(OC(=O)N2CCCCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H15N3O3/c1-12-7-8(9(14)11-12)16-10(15)13-5-3-2-4-6-13/h7H,2-6H2,1H3,(H,11,14) |
| InChIKey | HLENJVSFURBASO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |