C51H40BN5O3 — CID 156643450
(NE)-N'-(benzenecarboximidoyl)-11-phenyl-N-[[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]methylidene]indolo[2,3-a]carbazole-12-carboximidamide (PubChem CID 156643450) has the molecular formula C51H40BN5O3 and a molecular weight of 781.73 g/mol. Its IUPAC name is (NE)-N'-(benzenecarboximidoyl)-11-phenyl-N-[[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]methylidene]indolo[2,3-a]carbazole-12-carboximidamide.
| Compound Name | (NE)-N'-(benzenecarboximidoyl)-11-phenyl-N-[[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]methylidene]indolo[2,3-a]carbazole-12-carboximidamide |
|---|---|
| PubChem CID | 156643450 |
| Molecular Formula | C51H40BN5O3 |
| Molecular Weight | 781.73 g/mol |
| Exact Mass | 781.32 |
| IUPAC Name | (NE)-N'-(benzenecarboximidoyl)-11-phenyl-N-[[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-1-yl]methylidene]indolo[2,3-a]carbazole-12-carboximidamide |
| SMILES | [H]/N=C(/N=C(/N=C/c1cccc2oc3ccc(B4OC(C)(C)C(C)(C)O4)cc3c12)n1c2ccccc2c2ccc3c4ccccc4n(-c4ccccc4)c3c21)c1ccccc1 |
| InChI | InChI=1S/C51H40BN5O3/c1-50(2)51(3,4)60-52(59-50)34-26-29-43-40(30-34)45-33(18-15-25-44(45)58-43)31-54-49(55-48(53)32-16-7-5-8-17-32)57-42-24-14-12-22-37(42)39-28-27-38-36-21-11-13-23-41(36)56(46(38)47(39)57)35-19-9-6-10-20-35/h5-31,53H,1-4H3/b53-48+,54-31+,55-49- |
| InChIKey | ZOMOSBLARBQVQO-NMHWCZQSSA-N |
| XLogP | 11.44 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.73 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|