C23H34N4O2 — CID 156648965
1-[(2R,6R)-6-methyl-4-(8-methylquinolin-5-yl)morpholin-2-yl]-1-[(1-methylpiperidin-4-yl)amino]ethanol (PubChem CID 156648965) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 1-[(2R,6R)-6-methyl-4-(8-methylquinolin-5-yl)morpholin-2-yl]-1-[(1-methylpiperidin-4-yl)amino]ethanol.
| Compound Name | 1-[(2R,6R)-6-methyl-4-(8-methylquinolin-5-yl)morpholin-2-yl]-1-[(1-methylpiperidin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 156648965 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 1-[(2R,6R)-6-methyl-4-(8-methylquinolin-5-yl)morpholin-2-yl]-1-[(1-methylpiperidin-4-yl)amino]ethanol |
| SMILES | Cc1ccc(N2C[C@@H](C)O[C@@H](C(C)(O)NC3CCN(C)CC3)C2)c2cccnc12 |
| InChI | InChI=1S/C23H34N4O2/c1-16-7-8-20(19-6-5-11-24-22(16)19)27-14-17(2)29-21(15-27)23(3,28)25-18-9-12-26(4)13-10-18/h5-8,11,17-18,21,25,28H,9-10,12-15H2,1-4H3/t17-,21-,23?/m1/s1 |
| InChIKey | WDOAAQURVYDZGV-DHIFELSQSA-N |
| XLogP | 2.53 |
| TPSA | 60.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|