C34H34N4O8 — CID 156656803
2,6-bis[[2-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]methyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 156656803) has the molecular formula C34H34N4O8 and a molecular weight of 626.67 g/mol. Its IUPAC name is 2,6-bis[[2-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]methyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis[[2-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]methyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 156656803 |
| Molecular Formula | C34H34N4O8 |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | 2,6-bis[[2-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]methyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | O=C1C=CC(=O)N1CC1CCCCC1Cn1c(=O)c2cc3c(=O)n(CC4CCCCC4CN4C(=O)C=CC4=O)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C34H34N4O8/c39-27-9-10-28(40)35(27)15-19-5-1-3-7-21(19)17-37-31(43)23-13-25-26(14-24(23)32(37)44)34(46)38(33(25)45)18-22-8-4-2-6-20(22)16-36-29(41)11-12-30(36)42/h9-14,19-22H,1-8,15-18H2 |
| InChIKey | ZRXQFSUFBZHEMT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 152.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|