About 1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate
1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate (PubChem CID 156666448) has the molecular formula C10H7Br4O5S-
and a molecular weight of 558.84 g/mol. Its IUPAC name is 1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate.
Molecular Properties
| Compound Name | 1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate |
| PubChem CID | 156666448 |
| Molecular Formula | C10H7Br4O5S- |
| Molecular Weight | 558.84 g/mol |
| Exact Mass | 554.68 |
| IUPAC Name | 1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate |
| SMILES | O=C(OCC(CBr)S(=O)(=O)[O-])c1cc(Br)cc(Br)c1Br |
| InChI | InChI=1S/C10H8Br4O5S/c11-3-6(20(16,17)18)4-19-10(15)7-1-5(12)2-8(13)9(7)14/h1-2,6H,3-4H2,(H,16,17,18)/p-1 |
| InChIKey | SDDGOSSKMXFZOC-UHFFFAOYSA-M |
| XLogP | 3.44 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 558.84 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate?
The IUPAC name of 1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate (CID 156666448) is 1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate.
What is the SMILES notation for 1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate?
The canonical SMILES for 1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate is O=C(OCC(CBr)S(=O)(=O)[O-])c1cc(Br)cc(Br)c1Br.
What is the InChIKey of 1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate?
The InChIKey is SDDGOSSKMXFZOC-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H8Br4O5S/c11-3-6(20(16,17)18)4-19-10(15)7-1-5(12)2-8(13)9(7)14/h1-2,6H,3-4H2,(H,16,17,18)/p-1.
What are the key properties of 1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate?
1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate has a molecular weight of 558.84 g/mol, XLogP of 3.44, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate is sourced from PubChem (CID 156666448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).