C10H7Br4O5S- — CID 156666448
1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate (PubChem CID 156666448) has the molecular formula C10H7Br4O5S- and a molecular weight of 558.84 g/mol. Its IUPAC name is 1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate.
| Compound Name | 1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate |
|---|---|
| PubChem CID | 156666448 |
| Molecular Formula | C10H7Br4O5S- |
| Molecular Weight | 558.84 g/mol |
| Exact Mass | 554.68 |
| IUPAC Name | 1-bromo-3-(2,3,5-tribromobenzoyl)oxypropane-2-sulfonate |
| SMILES | O=C(OCC(CBr)S(=O)(=O)[O-])c1cc(Br)cc(Br)c1Br |
| InChI | InChI=1S/C10H8Br4O5S/c11-3-6(20(16,17)18)4-19-10(15)7-1-5(12)2-8(13)9(7)14/h1-2,6H,3-4H2,(H,16,17,18)/p-1 |
| InChIKey | SDDGOSSKMXFZOC-UHFFFAOYSA-M |
| XLogP | 3.44 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.84 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|