C15H11Br3O5S — CID 156666251
2,5-dimethyl-4-(2,3,5-tribromobenzoyl)oxybenzenesulfonic acid (PubChem CID 156666251) has the molecular formula C15H11Br3O5S and a molecular weight of 543.03 g/mol. Its IUPAC name is 2,5-dimethyl-4-(2,3,5-tribromobenzoyl)oxybenzenesulfonic acid.
| Compound Name | 2,5-dimethyl-4-(2,3,5-tribromobenzoyl)oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 156666251 |
| Molecular Formula | C15H11Br3O5S |
| Molecular Weight | 543.03 g/mol |
| Exact Mass | 539.79 |
| IUPAC Name | 2,5-dimethyl-4-(2,3,5-tribromobenzoyl)oxybenzenesulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c(C)cc1OC(=O)c1cc(Br)cc(Br)c1Br |
| InChI | InChI=1S/C15H11Br3O5S/c1-7-4-13(24(20,21)22)8(2)3-12(7)23-15(19)10-5-9(16)6-11(17)14(10)18/h3-6H,1-2H3,(H,20,21,22) |
| InChIKey | DFCCRGUPLKCRBW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.03 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|