C22H36O3 — CID 156675481
2-[(6R)-3-hydroxy-3,6,10-trimethylundecyl]-3,5-dimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 156675481) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is 2-[(6R)-3-hydroxy-3,6,10-trimethylundecyl]-3,5-dimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(6R)-3-hydroxy-3,6,10-trimethylundecyl]-3,5-dimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 156675481 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | 2-[(6R)-3-hydroxy-3,6,10-trimethylundecyl]-3,5-dimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C(CCC(C)(O)CC[C@H](C)CCCC(C)C)=C(C)C1=O |
| InChI | InChI=1S/C22H36O3/c1-15(2)8-7-9-16(3)10-12-22(6,25)13-11-19-18(5)21(24)17(4)14-20(19)23/h14-16,25H,7-13H2,1-6H3/t16-,22?/m1/s1 |
| InChIKey | GQSBPVZKCMROHB-XESZBRCGSA-N |
| XLogP | 5.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|