C29H50O4 — CID 14753697
3-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadecyl]-1,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione (PubChem CID 14753697) has the molecular formula C29H50O4 and a molecular weight of 462.72 g/mol. Its IUPAC name is 3-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadecyl]-1,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione.
| Compound Name | 3-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadecyl]-1,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
|---|---|
| PubChem CID | 14753697 |
| Molecular Formula | C29H50O4 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.37 |
| IUPAC Name | 3-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadecyl]-1,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| SMILES | CC1=C(CC[C@](C)(O)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C(=O)C2(C)OC2(C)C1=O |
| InChI | InChI=1S/C29H50O4/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-27(6,32)19-17-24-23(5)25(30)28(7)29(8,33-28)26(24)31/h20-22,32H,9-19H2,1-8H3/t21-,22-,27-,28?,29?/m1/s1 |
| InChIKey | XKMXNXGDIBTSKJ-KUKSGFQZSA-N |
| XLogP | 6.97 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|