C27H45BrO3 — CID 53473540
2-bromo-3-[(7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadecyl]-5-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 53473540) has the molecular formula C27H45BrO3 and a molecular weight of 497.56 g/mol. Its IUPAC name is 2-bromo-3-[(7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadecyl]-5-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-bromo-3-[(7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadecyl]-5-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 53473540 |
| Molecular Formula | C27H45BrO3 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 2-bromo-3-[(7R,11R)-3-hydroxy-3,7,11,15-tetramethylhexadecyl]-5-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C(Br)=C(CCC(C)(O)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C1=O |
| InChI | InChI=1S/C27H45BrO3/c1-19(2)10-7-11-20(3)12-8-13-21(4)14-9-16-27(6,31)17-15-23-25(28)24(29)18-22(5)26(23)30/h18-21,31H,7-17H2,1-6H3/t20-,21-,27?/m1/s1 |
| InChIKey | UISZIDGEYWMSMB-NLDIKOHWSA-N |
| XLogP | 7.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|