C27H46O3 — CID 166512070
2-[(6R,10R)-3-hydroxy-3,6,10,14-tetramethylpentadecyl]-3,5-dimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 166512070) has the molecular formula C27H46O3 and a molecular weight of 418.66 g/mol. Its IUPAC name is 2-[(6R,10R)-3-hydroxy-3,6,10,14-tetramethylpentadecyl]-3,5-dimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(6R,10R)-3-hydroxy-3,6,10,14-tetramethylpentadecyl]-3,5-dimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 166512070 |
| Molecular Formula | C27H46O3 |
| Molecular Weight | 418.66 g/mol |
| Exact Mass | 418.34 |
| IUPAC Name | 2-[(6R,10R)-3-hydroxy-3,6,10,14-tetramethylpentadecyl]-3,5-dimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C(CCC(C)(O)CC[C@H](C)CCC[C@H](C)CCCC(C)C)=C(C)C1=O |
| InChI | InChI=1S/C27H46O3/c1-19(2)10-8-11-20(3)12-9-13-21(4)14-16-27(7,30)17-15-24-23(6)26(29)22(5)18-25(24)28/h18-21,30H,8-17H2,1-7H3/t20-,21-,27?/m1/s1 |
| InChIKey | LMNVVXGMJNROJS-NLDIKOHWSA-N |
| XLogP | 6.98 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.66 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|