C37H50O7 — CID 156676338
[(1S,2R,3S,4R,6R,7R,14R)-4-ethyl-6-hydroxy-2,4,7-trimethyl-9-oxo-3-(phenylmethoxymethoxy)-14-tricyclo[5.4.3.01,8]tetradecanyl]methyl 2-phenylmethoxyacetate (PubChem CID 156676338) has the molecular formula C37H50O7 and a molecular weight of 606.80 g/mol. Its IUPAC name is [(1S,2R,3S,4R,6R,7R,14R)-4-ethyl-6-hydroxy-2,4,7-trimethyl-9-oxo-3-(phenylmethoxymethoxy)-14-tricyclo[5.4.3.01,8]tetradecanyl]methyl 2-phenylmethoxyacetate.
| Compound Name | [(1S,2R,3S,4R,6R,7R,14R)-4-ethyl-6-hydroxy-2,4,7-trimethyl-9-oxo-3-(phenylmethoxymethoxy)-14-tricyclo[5.4.3.01,8]tetradecanyl]methyl 2-phenylmethoxyacetate |
|---|---|
| PubChem CID | 156676338 |
| Molecular Formula | C37H50O7 |
| Molecular Weight | 606.80 g/mol |
| Exact Mass | 606.36 |
| IUPAC Name | [(1S,2R,3S,4R,6R,7R,14R)-4-ethyl-6-hydroxy-2,4,7-trimethyl-9-oxo-3-(phenylmethoxymethoxy)-14-tricyclo[5.4.3.01,8]tetradecanyl]methyl 2-phenylmethoxyacetate |
| SMILES | CC[C@]1(C)C[C@@H](O)[C@@]2(C)C3C(=O)CC[C@@]3(CC[C@H]2COC(=O)COCc2ccccc2)[C@@H](C)[C@@H]1OCOCc1ccccc1 |
| InChI | InChI=1S/C37H50O7/c1-5-35(3)20-31(39)36(4)29(23-43-32(40)24-41-21-27-12-8-6-9-13-27)16-18-37(19-17-30(38)33(36)37)26(2)34(35)44-25-42-22-28-14-10-7-11-15-28/h6-15,26,29,31,33-34,39H,5,16-25H2,1-4H3/t26-,29-,31+,33?,34-,35+,36-,37-/m0/s1 |
| InChIKey | ZNVOHKIKTROXRJ-PHOPDKKCSA-N |
| XLogP | 6.50 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.80 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|