C42H52O6Si — CID 156676378
[(5R,7R,8S,9R,10S,14R,15R)-7-ethyl-7,9-dimethyl-13-oxo-3,3-diphenyl-8-(phenylmethoxymethoxy)-4-oxa-3-silatetracyclo[8.4.3.01,5.010,14]heptadecan-15-yl]methyl acetate (PubChem CID 156676378) has the molecular formula C42H52O6Si and a molecular weight of 680.96 g/mol. Its IUPAC name is [(5R,7R,8S,9R,10S,14R,15R)-7-ethyl-7,9-dimethyl-13-oxo-3,3-diphenyl-8-(phenylmethoxymethoxy)-4-oxa-3-silatetracyclo[8.4.3.01,5.010,14]heptadecan-15-yl]methyl acetate.
| Compound Name | [(5R,7R,8S,9R,10S,14R,15R)-7-ethyl-7,9-dimethyl-13-oxo-3,3-diphenyl-8-(phenylmethoxymethoxy)-4-oxa-3-silatetracyclo[8.4.3.01,5.010,14]heptadecan-15-yl]methyl acetate |
|---|---|
| PubChem CID | 156676378 |
| Molecular Formula | C42H52O6Si |
| Molecular Weight | 680.96 g/mol |
| Exact Mass | 680.35 |
| IUPAC Name | [(5R,7R,8S,9R,10S,14R,15R)-7-ethyl-7,9-dimethyl-13-oxo-3,3-diphenyl-8-(phenylmethoxymethoxy)-4-oxa-3-silatetracyclo[8.4.3.01,5.010,14]heptadecan-15-yl]methyl acetate |
| SMILES | CC[C@]1(C)C[C@H]2O[Si](c3ccccc3)(c3ccccc3)CC23[C@H](COC(C)=O)CC[C@]2(CCC(=O)[C@@H]32)[C@@H](C)[C@@H]1OCOCc1ccccc1 |
| InChI | InChI=1S/C42H52O6Si/c1-5-40(4)25-37-42(28-49(48-37,34-17-11-7-12-18-34)35-19-13-8-14-20-35)33(27-46-31(3)43)21-23-41(24-22-36(44)38(41)42)30(2)39(40)47-29-45-26-32-15-9-6-10-16-32/h6-20,30,33,37-39H,5,21-29H2,1-4H3/t30-,33-,37+,38+,39-,40+,41-,42?/m0/s1 |
| InChIKey | TYCUYGFKIHDQBX-ZREZXUPXSA-N |
| XLogP | 7.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.96 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|