C38H52O6 — CID 156676379
(1S,2S,3S,4S,6R,7R,14S)-4-ethyl-6-hydroxy-2,4,7-trimethyl-14-(3-oxo-4-phenylmethoxybutyl)-3-(phenylmethoxymethoxy)tricyclo[5.4.3.01,8]tetradecan-9-one (PubChem CID 156676379) has the molecular formula C38H52O6 and a molecular weight of 604.83 g/mol. Its IUPAC name is (1S,2S,3S,4S,6R,7R,14S)-4-ethyl-6-hydroxy-2,4,7-trimethyl-14-(3-oxo-4-phenylmethoxybutyl)-3-(phenylmethoxymethoxy)tricyclo[5.4.3.01,8]tetradecan-9-one.
| Compound Name | (1S,2S,3S,4S,6R,7R,14S)-4-ethyl-6-hydroxy-2,4,7-trimethyl-14-(3-oxo-4-phenylmethoxybutyl)-3-(phenylmethoxymethoxy)tricyclo[5.4.3.01,8]tetradecan-9-one |
|---|---|
| PubChem CID | 156676379 |
| Molecular Formula | C38H52O6 |
| Molecular Weight | 604.83 g/mol |
| Exact Mass | 604.38 |
| IUPAC Name | (1S,2S,3S,4S,6R,7R,14S)-4-ethyl-6-hydroxy-2,4,7-trimethyl-14-(3-oxo-4-phenylmethoxybutyl)-3-(phenylmethoxymethoxy)tricyclo[5.4.3.01,8]tetradecan-9-one |
| SMILES | CC[C@@]1(C)C[C@@H](O)[C@@]2(C)C3C(=O)CC[C@@]3(CC[C@H]2CCC(=O)COCc2ccccc2)[C@H](C)[C@@H]1OCOCc1ccccc1 |
| InChI | InChI=1S/C38H52O6/c1-5-36(3)22-33(41)37(4)30(16-17-31(39)25-42-23-28-12-8-6-9-13-28)18-20-38(21-19-32(40)34(37)38)27(2)35(36)44-26-43-24-29-14-10-7-11-15-29/h6-15,27,30,33-35,41H,5,16-26H2,1-4H3/t27-,30-,33-,34?,35+,36+,37+,38+/m1/s1 |
| InChIKey | INMRQDPPXYBQNK-RVILIQFJSA-N |
| XLogP | 7.31 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.83 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|