C26H34O4 — CID 129275756
[(1R)-4-methyl-3-(phenylmethoxymethoxy)-1-prop-1-en-2-ylcyclohexyl]oxymethoxymethylbenzene (PubChem CID 129275756) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is [(1R)-4-methyl-3-(phenylmethoxymethoxy)-1-prop-1-en-2-ylcyclohexyl]oxymethoxymethylbenzene.
| Compound Name | [(1R)-4-methyl-3-(phenylmethoxymethoxy)-1-prop-1-en-2-ylcyclohexyl]oxymethoxymethylbenzene |
|---|---|
| PubChem CID | 129275756 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | [(1R)-4-methyl-3-(phenylmethoxymethoxy)-1-prop-1-en-2-ylcyclohexyl]oxymethoxymethylbenzene |
| SMILES | C=C(C)[C@@]1(OCOCc2ccccc2)CCC(C)C(OCOCc2ccccc2)C1 |
| InChI | InChI=1S/C26H34O4/c1-21(2)26(30-20-28-18-24-12-8-5-9-13-24)15-14-22(3)25(16-26)29-19-27-17-23-10-6-4-7-11-23/h4-13,22,25H,1,14-20H2,2-3H3/t22?,25?,26-/m1/s1 |
| InChIKey | WPSKRFVDTVRYDC-TXDAUAKNSA-N |
| XLogP | 5.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|