C32H38O6 — CID 129273249
(4aS)-4-ethenyl-4,7-dimethyl-4a,8-bis(phenylmethoxymethoxy)-8a-prop-1-ynyl-5,6,7,8-tetrahydro-3H-chromen-2-one (PubChem CID 129273249) has the molecular formula C32H38O6 and a molecular weight of 518.65 g/mol. Its IUPAC name is (4aS)-4-ethenyl-4,7-dimethyl-4a,8-bis(phenylmethoxymethoxy)-8a-prop-1-ynyl-5,6,7,8-tetrahydro-3H-chromen-2-one.
| Compound Name | (4aS)-4-ethenyl-4,7-dimethyl-4a,8-bis(phenylmethoxymethoxy)-8a-prop-1-ynyl-5,6,7,8-tetrahydro-3H-chromen-2-one |
|---|---|
| PubChem CID | 129273249 |
| Molecular Formula | C32H38O6 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | (4aS)-4-ethenyl-4,7-dimethyl-4a,8-bis(phenylmethoxymethoxy)-8a-prop-1-ynyl-5,6,7,8-tetrahydro-3H-chromen-2-one |
| SMILES | C=CC1(C)CC(=O)OC2(C#CC)C(OCOCc3ccccc3)C(C)CC[C@]12OCOCc1ccccc1 |
| InChI | InChI=1S/C32H38O6/c1-5-18-31-29(36-23-34-21-26-13-9-7-10-14-26)25(3)17-19-32(31,30(4,6-2)20-28(33)38-31)37-24-35-22-27-15-11-8-12-16-27/h6-16,25,29H,2,17,19-24H2,1,3-4H3/t25?,29?,30?,31?,32-/m0/s1 |
| InChIKey | WRJILMMAGCHIJF-SMTGCQDWSA-N |
| XLogP | 5.81 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|