C37H44O9 — CID 134467005
(8S)-5,16-dihydroxy-3,7,11-trimethyl-8,12-bis(phenylmethoxymethoxy)-4-prop-1-en-2-yl-13,17-dioxapentacyclo[5.5.3.22,6.01,8.02,6]heptadec-3-en-14-one (PubChem CID 134467005) has the molecular formula C37H44O9 and a molecular weight of 632.75 g/mol. Its IUPAC name is (8S)-5,16-dihydroxy-3,7,11-trimethyl-8,12-bis(phenylmethoxymethoxy)-4-prop-1-en-2-yl-13,17-dioxapentacyclo[5.5.3.22,6.01,8.02,6]heptadec-3-en-14-one.
| Compound Name | (8S)-5,16-dihydroxy-3,7,11-trimethyl-8,12-bis(phenylmethoxymethoxy)-4-prop-1-en-2-yl-13,17-dioxapentacyclo[5.5.3.22,6.01,8.02,6]heptadec-3-en-14-one |
|---|---|
| PubChem CID | 134467005 |
| Molecular Formula | C37H44O9 |
| Molecular Weight | 632.75 g/mol |
| Exact Mass | 632.30 |
| IUPAC Name | (8S)-5,16-dihydroxy-3,7,11-trimethyl-8,12-bis(phenylmethoxymethoxy)-4-prop-1-en-2-yl-13,17-dioxapentacyclo[5.5.3.22,6.01,8.02,6]heptadec-3-en-14-one |
| SMILES | C=C(C)C1=C(C)C23OC(O)C2(C1O)C1(C)CC(=O)OC32C(OCOCc3ccccc3)C(C)CC[C@]12OCOCc1ccccc1 |
| InChI | InChI=1S/C37H44O9/c1-23(2)29-25(4)36-35(30(29)39,32(40)46-36)33(5)18-28(38)45-37(36)31(43-21-41-19-26-12-8-6-9-13-26)24(3)16-17-34(33,37)44-22-42-20-27-14-10-7-11-15-27/h6-15,24,30-32,39-40H,1,16-22H2,2-5H3/t24?,30?,31?,32?,33?,34-,35?,36?,37?/m0/s1 |
| InChIKey | RHYCZWKSYCGXKD-APRWINQISA-N |
| XLogP | 4.95 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.75 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|