C31H36O6 — CID 139436981
3,7-dimethyl-2,6-bis(phenylmethoxymethoxy)-12-oxatricyclo[5.4.3.01,6]tetradec-8-en-10-yn-13-ol (PubChem CID 139436981) has the molecular formula C31H36O6 and a molecular weight of 504.62 g/mol. Its IUPAC name is 3,7-dimethyl-2,6-bis(phenylmethoxymethoxy)-12-oxatricyclo[5.4.3.01,6]tetradec-8-en-10-yn-13-ol.
| Compound Name | 3,7-dimethyl-2,6-bis(phenylmethoxymethoxy)-12-oxatricyclo[5.4.3.01,6]tetradec-8-en-10-yn-13-ol |
|---|---|
| PubChem CID | 139436981 |
| Molecular Formula | C31H36O6 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 3,7-dimethyl-2,6-bis(phenylmethoxymethoxy)-12-oxatricyclo[5.4.3.01,6]tetradec-8-en-10-yn-13-ol |
| SMILES | CC1CCC2(OCOCc3ccccc3)C3(C)C=CC#CC2(OC(O)C3)C1OCOCc1ccccc1 |
| InChI | InChI=1S/C31H36O6/c1-24-15-18-31(36-23-34-21-26-13-7-4-8-14-26)29(2)16-9-10-17-30(31,37-27(32)19-29)28(24)35-22-33-20-25-11-5-3-6-12-25/h3-9,11-14,16,24,27-28,32H,15,18-23H2,1-2H3 |
| InChIKey | CBGFMGPQMSROBM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|