C32H40O6 — CID 134466931
2-(4-ethoxybut-3-yn-2-yl)-5-methyl-2,6-bis(phenylmethoxymethoxy)-1-prop-1-ynylcyclohexan-1-ol (PubChem CID 134466931) has the molecular formula C32H40O6 and a molecular weight of 520.67 g/mol. Its IUPAC name is 2-(4-ethoxybut-3-yn-2-yl)-5-methyl-2,6-bis(phenylmethoxymethoxy)-1-prop-1-ynylcyclohexan-1-ol.
| Compound Name | 2-(4-ethoxybut-3-yn-2-yl)-5-methyl-2,6-bis(phenylmethoxymethoxy)-1-prop-1-ynylcyclohexan-1-ol |
|---|---|
| PubChem CID | 134466931 |
| Molecular Formula | C32H40O6 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | 2-(4-ethoxybut-3-yn-2-yl)-5-methyl-2,6-bis(phenylmethoxymethoxy)-1-prop-1-ynylcyclohexan-1-ol |
| SMILES | CC#CC1(O)C(OCOCc2ccccc2)C(C)CCC1(OCOCc1ccccc1)C(C)C#COCC |
| InChI | InChI=1S/C32H40O6/c1-5-19-31(33)30(37-24-35-22-28-13-9-7-10-14-28)26(3)17-20-32(31,27(4)18-21-34-6-2)38-25-36-23-29-15-11-8-12-16-29/h7-16,26-27,30,33H,6,17,20,22-25H2,1-4H3 |
| InChIKey | NBBXPFCIQMOYMD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|