C35H42O8 — CID 134466949
4-(cycloprop-2-en-1-ylmethyl)-2,8a,8b-trihydroxy-1,4,7-trimethyl-4a,8-bis(phenylmethoxymethoxy)-5,6,7,8-tetrahydro-3aH-cyclopenta[a]inden-3-one (PubChem CID 134466949) has the molecular formula C35H42O8 and a molecular weight of 590.71 g/mol. Its IUPAC name is 4-(cycloprop-2-en-1-ylmethyl)-2,8a,8b-trihydroxy-1,4,7-trimethyl-4a,8-bis(phenylmethoxymethoxy)-5,6,7,8-tetrahydro-3aH-cyclopenta[a]inden-3-one.
| Compound Name | 4-(cycloprop-2-en-1-ylmethyl)-2,8a,8b-trihydroxy-1,4,7-trimethyl-4a,8-bis(phenylmethoxymethoxy)-5,6,7,8-tetrahydro-3aH-cyclopenta[a]inden-3-one |
|---|---|
| PubChem CID | 134466949 |
| Molecular Formula | C35H42O8 |
| Molecular Weight | 590.71 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | 4-(cycloprop-2-en-1-ylmethyl)-2,8a,8b-trihydroxy-1,4,7-trimethyl-4a,8-bis(phenylmethoxymethoxy)-5,6,7,8-tetrahydro-3aH-cyclopenta[a]inden-3-one |
| SMILES | CC1=C(O)C(=O)C2C(C)(CC3C=C3)C3(OCOCc4ccccc4)CCC(C)C(OCOCc4ccccc4)C3(O)C12O |
| InChI | InChI=1S/C35H42O8/c1-23-16-17-33(43-22-41-20-27-12-8-5-9-13-27)32(3,18-25-14-15-25)30-29(37)28(36)24(2)34(30,38)35(33,39)31(23)42-21-40-19-26-10-6-4-7-11-26/h4-15,23,25,30-31,36,38-39H,16-22H2,1-3H3 |
| InChIKey | QVLVNZIQXASEPP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.71 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|