C32H38O6 — CID 134467011
(6S)-3,7,9-trimethyl-2,6-bis(phenylmethoxymethoxy)-12-oxatricyclo[5.4.3.01,6]tetradec-8-en-10-yn-13-ol (PubChem CID 134467011) has the molecular formula C32H38O6 and a molecular weight of 518.65 g/mol. Its IUPAC name is (6S)-3,7,9-trimethyl-2,6-bis(phenylmethoxymethoxy)-12-oxatricyclo[5.4.3.01,6]tetradec-8-en-10-yn-13-ol.
| Compound Name | (6S)-3,7,9-trimethyl-2,6-bis(phenylmethoxymethoxy)-12-oxatricyclo[5.4.3.01,6]tetradec-8-en-10-yn-13-ol |
|---|---|
| PubChem CID | 134467011 |
| Molecular Formula | C32H38O6 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | (6S)-3,7,9-trimethyl-2,6-bis(phenylmethoxymethoxy)-12-oxatricyclo[5.4.3.01,6]tetradec-8-en-10-yn-13-ol |
| SMILES | CC1=CC2(C)CC(O)OC3(C#C1)C(OCOCc1ccccc1)C(C)CC[C@]23OCOCc1ccccc1 |
| InChI | InChI=1S/C32H38O6/c1-24-14-16-31-29(36-22-34-20-26-10-6-4-7-11-26)25(2)15-17-32(31,30(3,18-24)19-28(33)38-31)37-23-35-21-27-12-8-5-9-13-27/h4-13,18,25,28-29,33H,15,17,19-23H2,1-3H3/t25?,28?,29?,30?,31?,32-/m0/s1 |
| InChIKey | SRXMLSKHBZJGBP-OLQPXWTCSA-N |
| XLogP | 5.35 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|