C32H40O7 — CID 129273287
2-(4-ethoxy-2-hydroxybut-3-yn-2-yl)-5-methyl-2,6-bis(phenylmethoxymethoxy)-1-prop-1-ynylcyclohexan-1-ol (PubChem CID 129273287) has the molecular formula C32H40O7 and a molecular weight of 536.67 g/mol. Its IUPAC name is 2-(4-ethoxy-2-hydroxybut-3-yn-2-yl)-5-methyl-2,6-bis(phenylmethoxymethoxy)-1-prop-1-ynylcyclohexan-1-ol.
| Compound Name | 2-(4-ethoxy-2-hydroxybut-3-yn-2-yl)-5-methyl-2,6-bis(phenylmethoxymethoxy)-1-prop-1-ynylcyclohexan-1-ol |
|---|---|
| PubChem CID | 129273287 |
| Molecular Formula | C32H40O7 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | 2-(4-ethoxy-2-hydroxybut-3-yn-2-yl)-5-methyl-2,6-bis(phenylmethoxymethoxy)-1-prop-1-ynylcyclohexan-1-ol |
| SMILES | CC#CC1(O)C(OCOCc2ccccc2)C(C)CCC1(OCOCc1ccccc1)C(C)(O)C#COCC |
| InChI | InChI=1S/C32H40O7/c1-5-18-31(34)29(38-24-36-22-27-13-9-7-10-14-27)26(3)17-19-32(31,30(4,33)20-21-35-6-2)39-25-37-23-28-15-11-8-12-16-28/h7-16,26,29,33-34H,6,17,19,22-25H2,1-4H3 |
| InChIKey | GEKRXSUNGBSRAY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|