C24H22BrO4S2+ — CID 156684227
2-[4-(10-oxothianthren-5-ium-5-yl)phenoxy]ethyl 2-bromo-2-methylpropanoate (PubChem CID 156684227) has the molecular formula C24H22BrO4S2+ and a molecular weight of 518.47 g/mol. Its IUPAC name is 2-[4-(10-oxothianthren-5-ium-5-yl)phenoxy]ethyl 2-bromo-2-methylpropanoate.
| Compound Name | 2-[4-(10-oxothianthren-5-ium-5-yl)phenoxy]ethyl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 156684227 |
| Molecular Formula | C24H22BrO4S2+ |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 517.01 |
| IUPAC Name | 2-[4-(10-oxothianthren-5-ium-5-yl)phenoxy]ethyl 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)OCCOc1ccc([S+]2c3ccccc3S(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H22BrO4S2/c1-24(2,25)23(26)29-16-15-28-17-11-13-18(14-12-17)30-19-7-3-5-9-21(19)31(27)22-10-6-4-8-20(22)30/h3-14H,15-16H2,1-2H3/q+1 |
| InChIKey | NXEBCXRUTMUMFJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|