C16H22Cl2NO2+ — CID 156686950
4-[1-[(2,4-dichlorophenyl)methyl]piperidin-1-ium-1-yl]butanoic acid (PubChem CID 156686950) has the molecular formula C16H22Cl2NO2+ and a molecular weight of 331.26 g/mol. Its IUPAC name is 4-[1-[(2,4-dichlorophenyl)methyl]piperidin-1-ium-1-yl]butanoic acid.
| Compound Name | 4-[1-[(2,4-dichlorophenyl)methyl]piperidin-1-ium-1-yl]butanoic acid |
|---|---|
| PubChem CID | 156686950 |
| Molecular Formula | C16H22Cl2NO2+ |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 4-[1-[(2,4-dichlorophenyl)methyl]piperidin-1-ium-1-yl]butanoic acid |
| SMILES | O=C(O)CCC[N+]1(Cc2ccc(Cl)cc2Cl)CCCCC1 |
| InChI | InChI=1S/C16H21Cl2NO2/c17-14-7-6-13(15(18)11-14)12-19(8-2-1-3-9-19)10-4-5-16(20)21/h6-7,11H,1-5,8-10,12H2/p+1 |
| InChIKey | CSPDZIWTMFMZHR-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|