C16H18F6N2O6S — CID 156693324
ethyl 3-[[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxymethyl]-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate (PubChem CID 156693324) has the molecular formula C16H18F6N2O6S and a molecular weight of 480.38 g/mol. Its IUPAC name is ethyl 3-[[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxymethyl]-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 3-[[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxymethyl]-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 156693324 |
| Molecular Formula | C16H18F6N2O6S |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | ethyl 3-[[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxymethyl]-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(OS(=O)(=O)C(F)(F)F)=C(COc2cc(C(F)(F)F)n(C)n2)C1 |
| InChI | InChI=1S/C16H18F6N2O6S/c1-3-28-14(25)9-4-5-11(30-31(26,27)16(20,21)22)10(6-9)8-29-13-7-12(15(17,18)19)24(2)23-13/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | NEQUOVIKPNSAEL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|