C28H38N2O6S — CID 156727243
6-(1-hydroxyethyl)-3-[[[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]methylamino]methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 156727243) has the molecular formula C28H38N2O6S and a molecular weight of 530.69 g/mol. Its IUPAC name is 6-(1-hydroxyethyl)-3-[[[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]methylamino]methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | 6-(1-hydroxyethyl)-3-[[[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]methylamino]methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 156727243 |
| Molecular Formula | C28H38N2O6S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 6-(1-hydroxyethyl)-3-[[[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]methylamino]methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2)c(OCNCC2=C(C(=O)O)N3C(=O)C(C(C)O)C3S2)c1 |
| InChI | InChI=1S/C28H38N2O6S/c1-4-5-6-9-18-12-20(32)24(19-10-7-8-16(2)11-19)21(13-18)36-15-29-14-22-25(28(34)35)30-26(33)23(17(3)31)27(30)37-22/h11-13,17,19,23,27,29,31-32H,4-10,14-15H2,1-3H3,(H,34,35) |
| InChIKey | HKUGOGWHALBUSJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|