C8H11N7O11 — CID 156729946
[(1S)-3-amino-1-carboxy-3-oxopropyl]azanium;1,2,3-trinitropyrazole-3-carboxylate (PubChem CID 156729946) has the molecular formula C8H11N7O11 and a molecular weight of 381.21 g/mol. Its IUPAC name is [(1S)-3-amino-1-carboxy-3-oxopropyl]azanium;1,2,3-trinitropyrazole-3-carboxylate.
| Compound Name | [(1S)-3-amino-1-carboxy-3-oxopropyl]azanium;1,2,3-trinitropyrazole-3-carboxylate |
|---|---|
| PubChem CID | 156729946 |
| Molecular Formula | C8H11N7O11 |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | [(1S)-3-amino-1-carboxy-3-oxopropyl]azanium;1,2,3-trinitropyrazole-3-carboxylate |
| SMILES | NC(=O)C[C@H]([NH3+])C(=O)O.O=C([O-])C1([N+](=O)[O-])C=CN([N+](=O)[O-])N1[N+](=O)[O-] |
| InChI | InChI=1S/C4H3N5O8.C4H8N2O3/c10-3(11)4(7(12)13)1-2-5(8(14)15)6(4)9(16)17;5-2(4(8)9)1-3(6)7/h1-2H,(H,10,11);2H,1,5H2,(H2,6,7)(H,8,9)/t;2-/m.0/s1 |
| InChIKey | KXTHAPACYMPNRZ-WNQIDUERSA-N |
| XLogP | -5.30 |
| TPSA | 284.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | -5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|