C6H13F4NO3S — CID 156741697
diethylazanium;1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 156741697) has the molecular formula C6H13F4NO3S and a molecular weight of 255.23 g/mol. Its IUPAC name is diethylazanium;1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | diethylazanium;1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 156741697 |
| Molecular Formula | C6H13F4NO3S |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | diethylazanium;1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | CC[NH2+]CC.O=S(=O)([O-])C(F)(F)C(F)F |
| InChI | InChI=1S/C4H11N.C2H2F4O3S/c1-3-5-4-2;3-1(4)2(5,6)10(7,8)9/h5H,3-4H2,1-2H3;1H,(H,7,8,9) |
| InChIKey | ZGGQOGONGQVIBW-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|