C52H91N — CID 156749356
1,3-ditert-butyl-5-ethenylbenzene;1-[(Z)-4,10-dimethylidene-7-propylheptacos-21-enyl]pyrrolidine (PubChem CID 156749356) has the molecular formula C52H91N and a molecular weight of 730.31 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-ethenylbenzene;1-[(Z)-4,10-dimethylidene-7-propylheptacos-21-enyl]pyrrolidine.
| Compound Name | 1,3-ditert-butyl-5-ethenylbenzene;1-[(Z)-4,10-dimethylidene-7-propylheptacos-21-enyl]pyrrolidine |
|---|---|
| PubChem CID | 156749356 |
| Molecular Formula | C52H91N |
| Molecular Weight | 730.31 g/mol |
| Exact Mass | 729.72 |
| IUPAC Name | 1,3-ditert-butyl-5-ethenylbenzene;1-[(Z)-4,10-dimethylidene-7-propylheptacos-21-enyl]pyrrolidine |
| SMILES | C=C(CCCCCCCCCC/C=C\CCCCC)CCC(CCC)CCC(=C)CCCN1CCCC1.C=Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H67N.C16H24/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-34(3)27-29-36(24-6-2)30-28-35(4)26-23-33-37-31-21-22-32-37;1-8-12-9-13(15(2,3)4)11-14(10-12)16(5,6)7/h10-11,36H,3-9,12-33H2,1-2H3;8-11H,1H2,2-7H3/b11-10-; |
| InChIKey | VGMBOTBJEPOSFW-GMFCBQQYSA-N |
| XLogP | 16.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.31 |
| LogP ≤ 5 | 16.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|