C50H96N4 — CID 156749374
2-cyclobutylbut-3-en-1-amine;1-ethyl-4-[4-[(19Z)-8-methylidene-5-propylpentacosa-1,19-dien-2-yl]piperidin-1-yl]piperidine;methanamine (PubChem CID 156749374) has the molecular formula C50H96N4 and a molecular weight of 753.35 g/mol. Its IUPAC name is 2-cyclobutylbut-3-en-1-amine;1-ethyl-4-[4-[(19Z)-8-methylidene-5-propylpentacosa-1,19-dien-2-yl]piperidin-1-yl]piperidine;methanamine.
| Compound Name | 2-cyclobutylbut-3-en-1-amine;1-ethyl-4-[4-[(19Z)-8-methylidene-5-propylpentacosa-1,19-dien-2-yl]piperidin-1-yl]piperidine;methanamine |
|---|---|
| PubChem CID | 156749374 |
| Molecular Formula | C50H96N4 |
| Molecular Weight | 753.35 g/mol |
| Exact Mass | 752.76 |
| IUPAC Name | 2-cyclobutylbut-3-en-1-amine;1-ethyl-4-[4-[(19Z)-8-methylidene-5-propylpentacosa-1,19-dien-2-yl]piperidin-1-yl]piperidine;methanamine |
| SMILES | C=C(CCCCCCCCCC/C=C\CCCCC)CCC(CCC)CCC(=C)C1CCN(C2CCN(CC)CC2)CC1.C=CC(CN)C1CCC1.CN |
| InChI | InChI=1S/C41H76N2.C8H15N.CH5N/c1-6-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24-37(4)25-27-39(23-7-2)28-26-38(5)40-29-35-43(36-30-40)41-31-33-42(8-3)34-32-41;1-2-7(6-9)8-4-3-5-8;1-2/h12-13,39-41H,4-11,14-36H2,1-3H3;2,7-8H,1,3-6,9H2;2H2,1H3/b13-12-;; |
| InChIKey | LAYBKZWXQWPBOZ-RWYDNECBSA-N |
| XLogP | 13.43 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.35 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|