C11H26N4O4 — CID 156750412
N-(2-aminoethyl)-4,5-dihydroxy-6-oxohexanamide;N'-methylethane-1,2-diamine (PubChem CID 156750412) has the molecular formula C11H26N4O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is N-(2-aminoethyl)-4,5-dihydroxy-6-oxohexanamide;N'-methylethane-1,2-diamine.
| Compound Name | N-(2-aminoethyl)-4,5-dihydroxy-6-oxohexanamide;N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 156750412 |
| Molecular Formula | C11H26N4O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N-(2-aminoethyl)-4,5-dihydroxy-6-oxohexanamide;N'-methylethane-1,2-diamine |
| SMILES | CNCCN.NCCNC(=O)CCC(O)C(O)C=O |
| InChI | InChI=1S/C8H16N2O4.C3H10N2/c9-3-4-10-8(14)2-1-6(12)7(13)5-11;1-5-3-2-4/h5-7,12-13H,1-4,9H2,(H,10,14);5H,2-4H2,1H3 |
| InChIKey | AHOPUXZRTGLXSI-UHFFFAOYSA-N |
| XLogP | -3.07 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|