C26H42IN3O6S — CID 156777403
3-[[6-methoxy-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-benzothiazol-5-yl]oxy]propyl-dimethyl-[2-(oxan-2-yloxy)ethyl]azanium iodide (PubChem CID 156777403) has the molecular formula C26H42IN3O6S and a molecular weight of 651.61 g/mol. Its IUPAC name is 3-[[6-methoxy-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-benzothiazol-5-yl]oxy]propyl-dimethyl-[2-(oxan-2-yloxy)ethyl]azanium iodide.
| Compound Name | 3-[[6-methoxy-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-benzothiazol-5-yl]oxy]propyl-dimethyl-[2-(oxan-2-yloxy)ethyl]azanium iodide |
|---|---|
| PubChem CID | 156777403 |
| Molecular Formula | C26H42IN3O6S |
| Molecular Weight | 651.61 g/mol |
| Exact Mass | 651.18 |
| IUPAC Name | 3-[[6-methoxy-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-benzothiazol-5-yl]oxy]propyl-dimethyl-[2-(oxan-2-yloxy)ethyl]azanium iodide |
| SMILES | COc1cc2sc(CNC(=O)OC(C)(C)C)nc2cc1OCCC[N+](C)(C)CCOC1CCCCO1.[I-] |
| InChI | InChI=1S/C26H41N3O6S.HI/c1-26(2,3)35-25(30)27-18-23-28-19-16-21(20(31-6)17-22(19)36-23)32-14-9-11-29(4,5)12-15-34-24-10-7-8-13-33-24;/h16-17,24H,7-15,18H2,1-6H3;1H |
| InChIKey | GSVVSPJAZZUINS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.61 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|