C26H26ClN5 — CID 156786755
2-(2-chlorophenyl)-5-[8-(4-methylimidazol-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 156786755) has the molecular formula C26H26ClN5 and a molecular weight of 443.98 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-5-[8-(4-methylimidazol-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 2-(2-chlorophenyl)-5-[8-(4-methylimidazol-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 156786755 |
| Molecular Formula | C26H26ClN5 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 2-(2-chlorophenyl)-5-[8-(4-methylimidazol-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | Cc1cn(-c2cccc3c2CC(N2CCc4nc(-c5ccccc5Cl)[nH]c4C2)CC3)cn1 |
| InChI | InChI=1S/C26H26ClN5/c1-17-14-32(16-28-17)25-8-4-5-18-9-10-19(13-21(18)25)31-12-11-23-24(15-31)30-26(29-23)20-6-2-3-7-22(20)27/h2-8,14,16,19H,9-13,15H2,1H3,(H,29,30) |
| InChIKey | YFMLDWJXDMKCMN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |