C20H22ClN5 — CID 156786888
5-[2-(2-chlorophenyl)-3-methyl-4,5,6,7-tetrahydrobenzimidazol-5-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 156786888) has the molecular formula C20H22ClN5 and a molecular weight of 367.88 g/mol. Its IUPAC name is 5-[2-(2-chlorophenyl)-3-methyl-4,5,6,7-tetrahydrobenzimidazol-5-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 5-[2-(2-chlorophenyl)-3-methyl-4,5,6,7-tetrahydrobenzimidazol-5-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 156786888 |
| Molecular Formula | C20H22ClN5 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 5-[2-(2-chlorophenyl)-3-methyl-4,5,6,7-tetrahydrobenzimidazol-5-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | Cn1c(-c2ccccc2Cl)nc2c1CC(N1CCc3nc[nH]c3C1)CC2 |
| InChI | InChI=1S/C20H22ClN5/c1-25-19-10-13(26-9-8-16-18(11-26)23-12-22-16)6-7-17(19)24-20(25)14-4-2-3-5-15(14)21/h2-5,12-13H,6-11H2,1H3,(H,22,23) |
| InChIKey | GNVXYDUFOYAWJS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |