C15H21BrN4O5 — CID 156791600
methyl 3-[(5-bromo-2-nitro-3-pyridinyl)amino]-2-(2,6-dimethylmorpholin-4-yl)propanoate (PubChem CID 156791600) has the molecular formula C15H21BrN4O5 and a molecular weight of 417.26 g/mol. Its IUPAC name is methyl 3-[(5-bromo-2-nitro-3-pyridinyl)amino]-2-(2,6-dimethylmorpholin-4-yl)propanoate.
| Compound Name | methyl 3-[(5-bromo-2-nitro-3-pyridinyl)amino]-2-(2,6-dimethylmorpholin-4-yl)propanoate |
|---|---|
| PubChem CID | 156791600 |
| Molecular Formula | C15H21BrN4O5 |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | methyl 3-[(5-bromo-2-nitro-3-pyridinyl)amino]-2-(2,6-dimethylmorpholin-4-yl)propanoate |
| SMILES | COC(=O)C(CNc1cc(Br)cnc1[N+](=O)[O-])N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C15H21BrN4O5/c1-9-7-19(8-10(2)25-9)13(15(21)24-3)6-17-12-4-11(16)5-18-14(12)20(22)23/h4-5,9-10,13,17H,6-8H2,1-3H3 |
| InChIKey | CUJWWDDSUMLCCN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|