C15H18N2O3 — CID 156794766
4-ethyl-2,3-dihydroisoindol-1-one;piperidine-2,6-dione (PubChem CID 156794766) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-ethyl-2,3-dihydroisoindol-1-one;piperidine-2,6-dione.
| Compound Name | 4-ethyl-2,3-dihydroisoindol-1-one;piperidine-2,6-dione |
|---|---|
| PubChem CID | 156794766 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4-ethyl-2,3-dihydroisoindol-1-one;piperidine-2,6-dione |
| SMILES | CCc1cccc2c1CNC2=O.O=C1CCCC(=O)N1 |
| InChI | InChI=1S/C10H11NO.C5H7NO2/c1-2-7-4-3-5-8-9(7)6-11-10(8)12;7-4-2-1-3-5(8)6-4/h3-5H,2,6H2,1H3,(H,11,12);1-3H2,(H,6,7,8) |
| InChIKey | STSGPEFMSAVYGK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|