C19H15BrClFN2O3 — CID 156809228
8-bromo-9-chloro-7-fluoro-1'-prop-2-enoylspiro[3H-pyrano[3,2-c]quinoline-2,4'-piperidine]-4-one (PubChem CID 156809228) has the molecular formula C19H15BrClFN2O3 and a molecular weight of 453.70 g/mol. Its IUPAC name is 8-bromo-9-chloro-7-fluoro-1'-prop-2-enoylspiro[3H-pyrano[3,2-c]quinoline-2,4'-piperidine]-4-one.
| Compound Name | 8-bromo-9-chloro-7-fluoro-1'-prop-2-enoylspiro[3H-pyrano[3,2-c]quinoline-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 156809228 |
| Molecular Formula | C19H15BrClFN2O3 |
| Molecular Weight | 453.70 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 8-bromo-9-chloro-7-fluoro-1'-prop-2-enoylspiro[3H-pyrano[3,2-c]quinoline-2,4'-piperidine]-4-one |
| SMILES | C=CC(=O)N1CCC2(CC1)CC(=O)c1cnc3c(F)c(Br)c(Cl)cc3c1O2 |
| InChI | InChI=1S/C19H15BrClFN2O3/c1-2-14(26)24-5-3-19(4-6-24)8-13(25)11-9-23-17-10(18(11)27-19)7-12(21)15(20)16(17)22/h2,7,9H,1,3-6,8H2 |
| InChIKey | LPDZMPIMOITEIU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.70 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|