C17H13BrClFN4O2 — CID 166667156
8-bromo-9-chloro-7-fluoro-1-prop-2-enoylspiro[4H-pyrazino[2,3-c]quinoline-2,3'-pyrrolidine]-3-one (PubChem CID 166667156) has the molecular formula C17H13BrClFN4O2 and a molecular weight of 439.67 g/mol. Its IUPAC name is 8-bromo-9-chloro-7-fluoro-1-prop-2-enoylspiro[4H-pyrazino[2,3-c]quinoline-2,3'-pyrrolidine]-3-one.
| Compound Name | 8-bromo-9-chloro-7-fluoro-1-prop-2-enoylspiro[4H-pyrazino[2,3-c]quinoline-2,3'-pyrrolidine]-3-one |
|---|---|
| PubChem CID | 166667156 |
| Molecular Formula | C17H13BrClFN4O2 |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | 8-bromo-9-chloro-7-fluoro-1-prop-2-enoylspiro[4H-pyrazino[2,3-c]quinoline-2,3'-pyrrolidine]-3-one |
| SMILES | C=CC(=O)N1c2c(cnc3c(F)c(Br)c(Cl)cc23)NC(=O)C12CCNC2 |
| InChI | InChI=1S/C17H13BrClFN4O2/c1-2-11(25)24-15-8-5-9(19)12(18)13(20)14(8)22-6-10(15)23-16(26)17(24)3-4-21-7-17/h2,5-6,21H,1,3-4,7H2,(H,23,26) |
| InChIKey | LDRBHSHUHZVBGN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|