C22H25F2N5O2 — CID 156810943
N-(2-aminoethyl)-3-[5-(3,3-difluoro-5-formamidopentyl)pyrrolo[2,3-b]pyridin-1-yl]benzamide (PubChem CID 156810943) has the molecular formula C22H25F2N5O2 and a molecular weight of 429.47 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-[5-(3,3-difluoro-5-formamidopentyl)pyrrolo[2,3-b]pyridin-1-yl]benzamide.
| Compound Name | N-(2-aminoethyl)-3-[5-(3,3-difluoro-5-formamidopentyl)pyrrolo[2,3-b]pyridin-1-yl]benzamide |
|---|---|
| PubChem CID | 156810943 |
| Molecular Formula | C22H25F2N5O2 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | N-(2-aminoethyl)-3-[5-(3,3-difluoro-5-formamidopentyl)pyrrolo[2,3-b]pyridin-1-yl]benzamide |
| SMILES | NCCNC(=O)c1cccc(-n2ccc3cc(CCC(F)(F)CCNC=O)cnc32)c1 |
| InChI | InChI=1S/C22H25F2N5O2/c23-22(24,7-9-26-15-30)6-4-16-12-17-5-11-29(20(17)28-14-16)19-3-1-2-18(13-19)21(31)27-10-8-25/h1-3,5,11-15H,4,6-10,25H2,(H,26,30)(H,27,31) |
| InChIKey | HBAROYFSRUDURW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|