About N-(4-cyclohexylphenyl)formamide;3-phenylpyrrolidine
N-(4-cyclohexylphenyl)formamide;3-phenylpyrrolidine (PubChem CID 156839471) has the molecular formula C23H30N2O
and a molecular weight of 350.51 g/mol. Its IUPAC name is N-(4-cyclohexylphenyl)formamide;3-phenylpyrrolidine.
Molecular Properties
| Compound Name | N-(4-cyclohexylphenyl)formamide;3-phenylpyrrolidine |
| PubChem CID | 156839471 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | N-(4-cyclohexylphenyl)formamide;3-phenylpyrrolidine |
| SMILES | O=CNc1ccc(C2CCCCC2)cc1.c1ccc(C2CCNC2)cc1 |
| InChI | InChI=1S/C13H17NO.C10H13N/c15-10-14-13-8-6-12(7-9-13)11-4-2-1-3-5-11;1-2-4-9(5-3-1)10-6-7-11-8-10/h6-11H,1-5H2,(H,14,15);1-5,10-11H,6-8H2 |
| InChIKey | KATHYGFLKJCPRV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(4-cyclohexylphenyl)formamide;3-phenylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyclohexylphenyl)formamide;3-phenylpyrrolidine?
The IUPAC name of N-(4-cyclohexylphenyl)formamide;3-phenylpyrrolidine (CID 156839471) is N-(4-cyclohexylphenyl)formamide;3-phenylpyrrolidine.
What is the SMILES notation for N-(4-cyclohexylphenyl)formamide;3-phenylpyrrolidine?
The canonical SMILES for N-(4-cyclohexylphenyl)formamide;3-phenylpyrrolidine is O=CNc1ccc(C2CCCCC2)cc1.c1ccc(C2CCNC2)cc1.
What is the InChIKey of N-(4-cyclohexylphenyl)formamide;3-phenylpyrrolidine?
The InChIKey is KATHYGFLKJCPRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO.C10H13N/c15-10-14-13-8-6-12(7-9-13)11-4-2-1-3-5-11;1-2-4-9(5-3-1)10-6-7-11-8-10/h6-11H,1-5H2,(H,14,15);1-5,10-11H,6-8H2.
What are the key properties of N-(4-cyclohexylphenyl)formamide;3-phenylpyrrolidine?
N-(4-cyclohexylphenyl)formamide;3-phenylpyrrolidine has a molecular weight of 350.51 g/mol, XLogP of 5.07, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyclohexylphenyl)formamide;3-phenylpyrrolidine is sourced from PubChem (CID 156839471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).