About 3-[(E)-but-1-enyl]aniline;N-methylethanimine
3-[(E)-but-1-enyl]aniline;N-methylethanimine (PubChem CID 156839565) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 3-[(E)-but-1-enyl]aniline;N-methylethanimine.
Molecular Properties
| Compound Name | 3-[(E)-but-1-enyl]aniline;N-methylethanimine |
| PubChem CID | 156839565 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 3-[(E)-but-1-enyl]aniline;N-methylethanimine |
| SMILES | C/C=N/C.CC/C=C/c1cccc(N)c1 |
| InChI | InChI=1S/C10H13N.C3H7N/c1-2-3-5-9-6-4-7-10(11)8-9;1-3-4-2/h3-8H,2,11H2,1H3;3H,1-2H3/b5-3+;4-3+ |
| InChIKey | WSPFRKHDCDTGTI-ZSTZNOIXSA-N |
| XLogP | 3.40 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-but-1-enyl]aniline;N-methylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-but-1-enyl]aniline;N-methylethanimine?
The IUPAC name of 3-[(E)-but-1-enyl]aniline;N-methylethanimine (CID 156839565) is 3-[(E)-but-1-enyl]aniline;N-methylethanimine.
What is the SMILES notation for 3-[(E)-but-1-enyl]aniline;N-methylethanimine?
The canonical SMILES for 3-[(E)-but-1-enyl]aniline;N-methylethanimine is C/C=N/C.CC/C=C/c1cccc(N)c1.
What is the InChIKey of 3-[(E)-but-1-enyl]aniline;N-methylethanimine?
The InChIKey is WSPFRKHDCDTGTI-ZSTZNOIXSA-N. The full InChI is InChI=1S/C10H13N.C3H7N/c1-2-3-5-9-6-4-7-10(11)8-9;1-3-4-2/h3-8H,2,11H2,1H3;3H,1-2H3/b5-3+;4-3+.
What are the key properties of 3-[(E)-but-1-enyl]aniline;N-methylethanimine?
3-[(E)-but-1-enyl]aniline;N-methylethanimine has a molecular weight of 204.32 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-but-1-enyl]aniline;N-methylethanimine is sourced from PubChem (CID 156839565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).