C27H16Cl4KNO4 — CID 156842411
potassium 4,5,6,7-tetrachloro-6'-[cyclohexa-1,5-dien-1-yl(methyl)amino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-olate (PubChem CID 156842411) has the molecular formula C27H16Cl4KNO4 and a molecular weight of 599.34 g/mol. Its IUPAC name is potassium 4,5,6,7-tetrachloro-6'-[cyclohexa-1,5-dien-1-yl(methyl)amino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-olate.
| Compound Name | potassium 4,5,6,7-tetrachloro-6'-[cyclohexa-1,5-dien-1-yl(methyl)amino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-olate |
|---|---|
| PubChem CID | 156842411 |
| Molecular Formula | C27H16Cl4KNO4 |
| Molecular Weight | 599.34 g/mol |
| Exact Mass | 596.95 |
| IUPAC Name | potassium 4,5,6,7-tetrachloro-6'-[cyclohexa-1,5-dien-1-yl(methyl)amino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-olate |
| SMILES | CN(C1=CCCC=C1)c1ccc2c(c1)Oc1cc([O-])ccc1C21OC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c21.[K+] |
| InChI | InChI=1S/C27H17Cl4NO4.K/c1-32(13-5-3-2-4-6-13)14-7-9-16-18(11-14)35-19-12-15(33)8-10-17(19)27(16)21-20(26(34)36-27)22(28)24(30)25(31)23(21)29;/h3,5-12,33H,2,4H2,1H3;/q;+1/p-1 |
| InChIKey | UTEWJFAXQXSUKX-UHFFFAOYSA-M |
| XLogP | 4.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|