C20H8Cl4Na2O4 — CID 71586754
disodium;4-[4,5,6,7-tetrachloro-1-(4-oxidophenyl)-3-oxo-2-benzofuran-1-yl]phenolate (PubChem CID 71586754) has the molecular formula C20H8Cl4Na2O4 and a molecular weight of 500.07 g/mol. Its IUPAC name is disodium;4-[4,5,6,7-tetrachloro-1-(4-oxidophenyl)-3-oxo-2-benzofuran-1-yl]phenolate.
| Compound Name | disodium;4-[4,5,6,7-tetrachloro-1-(4-oxidophenyl)-3-oxo-2-benzofuran-1-yl]phenolate |
|---|---|
| PubChem CID | 71586754 |
| Molecular Formula | C20H8Cl4Na2O4 |
| Molecular Weight | 500.07 g/mol |
| Exact Mass | 497.90 |
| IUPAC Name | disodium;4-[4,5,6,7-tetrachloro-1-(4-oxidophenyl)-3-oxo-2-benzofuran-1-yl]phenolate |
| SMILES | O=C1OC(c2ccc([O-])cc2)(c2ccc([O-])cc2)c2c(Cl)c(Cl)c(Cl)c(Cl)c21.[Na+].[Na+] |
| InChI | InChI=1S/C20H10Cl4O4.2Na/c21-15-13-14(16(22)18(24)17(15)23)20(28-19(13)27,9-1-5-11(25)6-2-9)10-3-7-12(26)8-4-10;;/h1-8,25-26H;;/q;2*+1/p-2 |
| InChIKey | SDOKJKPKCHVKIN-UHFFFAOYSA-L |
| XLogP | -1.08 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.07 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|