C13H11Cl2NOS — CID 156849199
[3-cyclopropyl-1-(3,4-dichlorophenyl)-1-oxopropan-2-yl] thiocyanate (PubChem CID 156849199) has the molecular formula C13H11Cl2NOS and a molecular weight of 300.21 g/mol. Its IUPAC name is [3-cyclopropyl-1-(3,4-dichlorophenyl)-1-oxopropan-2-yl] thiocyanate.
| Compound Name | [3-cyclopropyl-1-(3,4-dichlorophenyl)-1-oxopropan-2-yl] thiocyanate |
|---|---|
| PubChem CID | 156849199 |
| Molecular Formula | C13H11Cl2NOS |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | [3-cyclopropyl-1-(3,4-dichlorophenyl)-1-oxopropan-2-yl] thiocyanate |
| SMILES | N#CSC(CC1CC1)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2NOS/c14-10-4-3-9(6-11(10)15)13(17)12(18-7-16)5-8-1-2-8/h3-4,6,8,12H,1-2,5H2 |
| InChIKey | PVNJOAPFQQRWIO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|