C34H36Cl4N2O3 — CID 156884836
(3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-4-oxopiperidine-1-carbaldehyde;N-methylbutanamide;propylbenzene (PubChem CID 156884836) has the molecular formula C34H36Cl4N2O3 and a molecular weight of 662.49 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-4-oxopiperidine-1-carbaldehyde;N-methylbutanamide;propylbenzene.
| Compound Name | (3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-4-oxopiperidine-1-carbaldehyde;N-methylbutanamide;propylbenzene |
|---|---|
| PubChem CID | 156884836 |
| Molecular Formula | C34H36Cl4N2O3 |
| Molecular Weight | 662.49 g/mol |
| Exact Mass | 660.15 |
| IUPAC Name | (3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-4-oxopiperidine-1-carbaldehyde;N-methylbutanamide;propylbenzene |
| SMILES | CCCC(=O)NC.CCCc1ccccc1.O=CN1C/C(=C\c2ccc(Cl)c(Cl)c2)C(=O)/C(=C/c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C20H13Cl4NO2.C9H12.C5H11NO/c21-16-3-1-12(7-18(16)23)5-14-9-25(11-26)10-15(20(14)27)6-13-2-4-17(22)19(24)8-13;1-2-6-9-7-4-3-5-8-9;1-3-4-5(7)6-2/h1-8,11H,9-10H2;3-5,7-8H,2,6H2,1H3;3-4H2,1-2H3,(H,6,7)/b14-5+,15-6+;; |
| InChIKey | SAHIURJVUJZUCY-KKESQRLXSA-N |
| XLogP | 8.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.49 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|