C21H22ClFN2O2 — CID 156897898
N-(3-chloro-4-fluorophenyl)-1,5-dimethyl-3-(5-oxo-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl)pyrrole-2-carboxamide (PubChem CID 156897898) has the molecular formula C21H22ClFN2O2 and a molecular weight of 388.87 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-1,5-dimethyl-3-(5-oxo-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl)pyrrole-2-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-1,5-dimethyl-3-(5-oxo-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 156897898 |
| Molecular Formula | C21H22ClFN2O2 |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-1,5-dimethyl-3-(5-oxo-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl)pyrrole-2-carboxamide |
| SMILES | Cc1cc(C2CC3CC(=O)CC3C2)c(C(=O)Nc2ccc(F)c(Cl)c2)n1C |
| InChI | InChI=1S/C21H22ClFN2O2/c1-11-5-17(14-6-12-8-16(26)9-13(12)7-14)20(25(11)2)21(27)24-15-3-4-19(23)18(22)10-15/h3-5,10,12-14H,6-9H2,1-2H3,(H,24,27) |
| InChIKey | KCMNCTJSKYJWCZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |