C23H28Cl2FN3O2 — CID 156897835
5-(5-butyl-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl)-2-chloro-N-(3-chloro-4-fluorophenyl)-3-methylimidazole-4-carboxamide (PubChem CID 156897835) has the molecular formula C23H28Cl2FN3O2 and a molecular weight of 468.40 g/mol. Its IUPAC name is 5-(5-butyl-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl)-2-chloro-N-(3-chloro-4-fluorophenyl)-3-methylimidazole-4-carboxamide.
| Compound Name | 5-(5-butyl-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl)-2-chloro-N-(3-chloro-4-fluorophenyl)-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 156897835 |
| Molecular Formula | C23H28Cl2FN3O2 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 5-(5-butyl-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl)-2-chloro-N-(3-chloro-4-fluorophenyl)-3-methylimidazole-4-carboxamide |
| SMILES | CCCCC1(O)CC2CC(c3nc(Cl)n(C)c3C(=O)Nc3ccc(F)c(Cl)c3)CC2C1 |
| InChI | InChI=1S/C23H28Cl2FN3O2/c1-3-4-7-23(31)11-14-8-13(9-15(14)12-23)19-20(29(2)22(25)28-19)21(30)27-16-5-6-18(26)17(24)10-16/h5-6,10,13-15,31H,3-4,7-9,11-12H2,1-2H3,(H,27,30) |
| InChIKey | GDACERIPXSRGCX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |