C20H21Cl2FN2O2 — CID 156897943
5-chloro-N-(3-chloro-4-fluorophenyl)-3-(5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-1-methylpyrrole-2-carboxamide (PubChem CID 156897943) has the molecular formula C20H21Cl2FN2O2 and a molecular weight of 411.30 g/mol. Its IUPAC name is 5-chloro-N-(3-chloro-4-fluorophenyl)-3-(5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 5-chloro-N-(3-chloro-4-fluorophenyl)-3-(5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 156897943 |
| Molecular Formula | C20H21Cl2FN2O2 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 5-chloro-N-(3-chloro-4-fluorophenyl)-3-(5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1c(Cl)cc(C2CC3CC(O)CC3C2)c1C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C20H21Cl2FN2O2/c1-25-18(22)9-15(12-4-10-6-14(26)7-11(10)5-12)19(25)20(27)24-13-2-3-17(23)16(21)8-13/h2-3,8-12,14,26H,4-7H2,1H3,(H,24,27) |
| InChIKey | VATFKPFWMVYVLL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |