C19H22N6O4 — CID 15690127
(2R,3R,4S,5R)-2-[6-amino-2-(2,3-dihydro-1H-inden-2-ylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 15690127) has the molecular formula C19H22N6O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-2-(2,3-dihydro-1H-inden-2-ylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-2-(2,3-dihydro-1H-inden-2-ylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 15690127 |
| Molecular Formula | C19H22N6O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-2-(2,3-dihydro-1H-inden-2-ylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(NC2Cc3ccccc3C2)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H22N6O4/c20-16-13-17(25(8-21-13)18-15(28)14(27)12(7-26)29-18)24-19(23-16)22-11-5-9-3-1-2-4-10(9)6-11/h1-4,8,11-12,14-15,18,26-28H,5-7H2,(H3,20,22,23,24)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | VRTUKBNLDWESNL-SCFUHWHPSA-N |
| XLogP | -0.40 |
| TPSA | 151.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |