C17H25NO2 — CID 156904929
ethyl 7-hexyl-9-azabicyclo[4.2.1]nona-2,4,7-triene-9-carboxylate (PubChem CID 156904929) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is ethyl 7-hexyl-9-azabicyclo[4.2.1]nona-2,4,7-triene-9-carboxylate.
| Compound Name | ethyl 7-hexyl-9-azabicyclo[4.2.1]nona-2,4,7-triene-9-carboxylate |
|---|---|
| PubChem CID | 156904929 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | ethyl 7-hexyl-9-azabicyclo[4.2.1]nona-2,4,7-triene-9-carboxylate |
| SMILES | CCCCCCC1=CC2C=CC=CC1N2C(=O)OCC |
| InChI | InChI=1S/C17H25NO2/c1-3-5-6-7-10-14-13-15-11-8-9-12-16(14)18(15)17(19)20-4-2/h8-9,11-13,15-16H,3-7,10H2,1-2H3 |
| InChIKey | FBNXDWGPGDTTLH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|